|
CAS#: 6633-25-6 Product: 2,9-Dibromo-9H-Fluorene No suppilers available for the product. |
| Name | 2,9-Dibromo-9H-Fluorene |
|---|---|
| Synonyms | Nciopen2_007498; Nsc56667 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Br2 |
| Molecular Weight | 324.01 |
| CAS Registry Number | 6633-25-6 |
| SMILES | C1=C(Br)C=CC2=C1C(Br)C3=C2C=CC=C3 |
| InChI | 1S/C13H8Br2/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7,13H |
| InChIKey | LCSRSFIWOSPUNG-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.479°C at 760 mmHg (Cal.) |
| Flash point | 208.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,9-Dibromo-9H-Fluorene |