|
CAS#: 6633-46-1 Product: 3-Hydroxyfluoren-9-One No suppilers available for the product. |
| Name | 3-Hydroxyfluoren-9-One |
|---|---|
| Synonyms | 3-Hydroxy-9-Fluorenone; Nsc56698 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.21 |
| CAS Registry Number | 6633-46-1 |
| SMILES | C1=CC=CC2=C1C3=C(C2=O)C=CC(=C3)O |
| InChI | 1S/C13H8O2/c14-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(11)15/h1-7,14H |
| InChIKey | KLABHKQINQEQOG-UHFFFAOYSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.931°C at 760 mmHg (Cal.) |
| Flash point | 161.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxyfluoren-9-One |