|
CAS#: 66969-03-7 Product: 3',4',5'-Trimethylacetophenone Thiosemicarbazone No suppilers available for the product. |
| Name | 3',4',5'-Trimethylacetophenone Thiosemicarbazone |
|---|---|
| Synonyms | 3,4,5-Trimethylacetophenonethiosemicarbazone; Acetophenone, 3',4',5'-Trimethyl-, Thiosemicarbazone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.35 |
| CAS Registry Number | 66969-03-7 |
| SMILES | C1=C(C(=N/NC(=S)N)\C)C=C(C(=C1C)C)C |
| InChI | 1S/C12H17N3S/c1-7-5-11(6-8(2)9(7)3)10(4)14-15-12(13)16/h5-6H,1-4H3,(H3,13,15,16)/b14-10- |
| InChIKey | XFWCERHQAWYSFZ-UVTDQMKNSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.742°C at 760 mmHg (Cal.) |
| Flash point | 187.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',4',5'-Trimethylacetophenone Thiosemicarbazone |