|
CAS#: 68906-24-1 Product: 4-(2,4,6-Trichlorophenoxy)Phenol No suppilers available for the product. |
| Name | 4-(2,4,6-Trichlorophenoxy)Phenol |
|---|---|
| Synonyms | Ccris 8004; Hydroxychlornitrofen |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | 289.55 |
| CAS Registry Number | 68906-24-1 |
| SMILES | C1=CC(=CC=C1O)OC2=C(C=C(C=C2Cl)Cl)Cl |
| InChI | 1S/C12H7Cl3O2/c13-7-5-10(14)12(11(15)6-7)17-9-3-1-8(16)2-4-9/h1-6,16H |
| InChIKey | PWJFMODCCVSDJZ-UHFFFAOYSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.425°C at 760 mmHg (Cal.) |
| Flash point | 173.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,4,6-Trichlorophenoxy)Phenol |