|
CAS#: 73790-90-6 Product: (E)-N-Methyl-3-(3,4,5-Trimethoxyphenyl)Prop-2-Enamide No suppilers available for the product. |
| Name | (E)-N-Methyl-3-(3,4,5-Trimethoxyphenyl)Prop-2-Enamide |
|---|---|
| Synonyms | (E)-N-Methyl-3-(3,4,5-Trimethoxyphenyl)Acrylamide; 2-Propenamide, N-Methyl-3-(3,4,5-Trimethoxyphenyl)-; Brn 2384913 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 73790-90-6 |
| SMILES | C1=C(C(=C(C=C1\C=C\C(NC)=O)OC)OC)OC |
| InChI | 1S/C13H17NO4/c1-14-12(15)6-5-9-7-10(16-2)13(18-4)11(8-9)17-3/h5-8H,1-4H3,(H,14,15)/b6-5+ |
| InChIKey | IWUMZEUJTOEUIF-AATRIKPKSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.513°C at 760 mmHg (Cal.) |
| Flash point | 228.682°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-N-Methyl-3-(3,4,5-Trimethoxyphenyl)Prop-2-Enamide |