|
CAS#: 885268-55-3 Product: 2-(5-Chloro-1,2,3,4-tetrahydro-4-isoquinolinyl)ethanol No suppilers available for the product. |
| Name | 2-(5-Chloro-1,2,3,4-tetrahydro-4-isoquinolinyl)ethanol |
|---|---|
| Synonyms | 2-(5-Chlor-1,2,3,4-tetrahydro-4-isochinolinyl)ethanol; 2-(5-Chloro-1,2,3,4-tétrahydro-4-isoquinoléinyl)éthanol; 2-(5-Chloro-1,2,3,4-tetrahydro-4-isoquinolinyl)ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 |
| CAS Registry Number | 885268-55-3 |
| SMILES | c1cc2c(c(c1)Cl)C(CNC2)CCO |
| InChI | 1S/C11H14ClNO/c12-10-3-1-2-8-6-13-7-9(4-5-14)11(8)10/h1-3,9,13-14H,4-7H2 |
| InChIKey | WCMPXYYISLKSAY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.2±42.0°C at 760 mmHg (Cal.) |
| Flash point | 158.3±27.9°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(5-Chloro-1,2,3,4-tetrahydro-4-isoquinolinyl)ethanol |