| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 1-Chloro-3,5-dimethoxy-2-nitrobenzene |
|---|---|
| Synonyms | 1-Chloro-3,5-Dimethoxy-2-Nitro-Benzene; Benzene, 1-Chloro-3,5-Dimethoxy-2-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNO4 |
| Molecular Weight | 217.61 |
| CAS Registry Number | 90-25-5 |
| EINECS | 201-979-9 |
| SMILES | C1=C(C=C(C(=C1Cl)[N+]([O-])=O)OC)OC |
| InChI | 1S/C8H8ClNO4/c1-13-5-3-6(9)8(10(11)12)7(4-5)14-2/h3-4H,1-2H3 |
| InChIKey | VHLPIOGWYXZJJT-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.188°C at 760 mmHg (Cal.) |
| Flash point | 166.798°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3,5-dimethoxy-2-nitrobenzene |