|
CAS#: 91987-94-9 Product: 4-Deoxyverrucarol No suppilers available for the product. |
| Name | 4-Deoxyverrucarol |
|---|---|
| Synonyms | 4-Dove; Trichothec-9-En-15-Ol, 12,13-Epoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 |
| CAS Registry Number | 91987-94-9 |
| SMILES | [C@@]24(C1(OC1)[C@@H](O[C@H]3[C@@]2(CCC(=C3)C)CO)CC4)C |
| InChI | 1S/C15H22O3/c1-10-3-6-14(8-16)12(7-10)18-11-4-5-13(14,2)15(11)9-17-15/h7,11-12,16H,3-6,8-9H2,1-2H3/t11-,12+,13+,14+,15?/m0/s1 |
| InChIKey | PIKGDUXACSBRJF-HHKCZIBZSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.203°C at 760 mmHg (Cal.) |
| Flash point | 178.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Deoxyverrucarol |