|
CAS#: 94201-16-8 Product: 2-(1-Methylethyl)-3-[(2-Methyl-3-Thienyl)Thio]Pyrazine No suppilers available for the product. |
| Name | 2-(1-Methylethyl)-3-[(2-Methyl-3-Thienyl)Thio]Pyrazine |
|---|---|
| Synonyms | 2-Isopropyl-3-[(2-Methyl-3-Thienyl)Sulfanyl]Pyrazine; 2-Isopropyl-3-[(2-Methyl-3-Thienyl)Thio]Pyrazine; 2-(2-Methylthiophen-3-Yl)Sulfanyl-3-Propan-2-Yl-Pyrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14N2S2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 94201-16-8 |
| EINECS | 303-598-4 |
| SMILES | C1=CC(=C(S1)C)SC2=NC=CN=C2C(C)C |
| InChI | 1S/C12H14N2S2/c1-8(2)11-12(14-6-5-13-11)16-10-4-7-15-9(10)3/h4-8H,1-3H3 |
| InChIKey | VTNHXYJLRZHYLW-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.76°C at 760 mmHg (Cal.) |
| Flash point | 150.21°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Methylethyl)-3-[(2-Methyl-3-Thienyl)Thio]Pyrazine |