|
CAS#: 944900-27-0 Product: 5-Amino-2-(trifluoromethyl)isonicotinic acid No suppilers available for the product. |
| Name | 5-Amino-2-(trifluoromethyl)isonicotinic acid |
|---|---|
| Synonyms | 5-Amino-2-trifluoromethyl-isonicotinicacid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.12 |
| CAS Registry Number | 944900-27-0 |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)N)C(=O)O |
| InChI | 1S/C7H5F3N2O2/c8-7(9,10)5-1-3(6(13)14)4(11)2-12-5/h1-2H,11H2,(H,13,14) |
| InChIKey | UTORUAWKVSIHOQ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 210.1±28.7°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2-(trifluoromethyl)isonicotinic acid |