| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Nile Chemicals | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (22) 6631-3162 | |||
![]() |
nilechem@vsnl.net | |||
| Chemical manufacturer | ||||
| RIA International LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Name | Isoproterenol hydrochloride |
|---|---|
| Synonyms | 4-[1-Hydroxy-2-(Isopropylamino)Ethyl]Benzene-1,2-Diol Hydrochloride; 4-[1-Hydroxy-2-(Isopropylamino)Ethyl]Pyrocatechol Hydrochloride; Spectrum1500357 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 |
| CAS Registry Number | 949-36-0 |
| EINECS | 213-438-4 |
| SMILES | [H+].C1=C(C(O)CNC(C)C)C=CC(=C1O)O.[Cl-] |
| InChI | 1S/C11H17NO3.ClH/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8;/h3-5,7,11-15H,6H2,1-2H3;1H |
| InChIKey | IROWCYIEJAOFOW-UHFFFAOYSA-N |
| Boiling point | 417.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.7°C (Cal.) |
| solubility | Soluble to 100 mM in water |
| Market Analysis Reports |
| List of Reports Available for Isoproterenol hydrochloride |