Online Database of Chemicals from Around the World
|
CAS#: 99948-56-8 Product: N-Methyl-3-(4'-Aminophenyl)-3-Ethylpyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | N-Methyl-3-(4'-Aminophenyl)-3-Ethylpyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 3-(4-Aminophenyl)-3-Ethyl-1-Methyl-Pyrrolidine-2,5-Dione; 3-(4-Aminophenyl)-3-Ethyl-1-Methyl-Pyrrolidine-2,5-Quinone; Mapepd |
| Molecular Structure |  |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 99948-56-8 |
| SMILES | C2=C(C1(CC(N(C1=O)C)=O)CC)C=CC(=C2)N |
| InChI | 1S/C13H16N2O2/c1-3-13(8-11(16)15(2)12(13)17)9-4-6-10(14)7-5-9/h4-7H,3,8,14H2,1-2H3 |
| InChIKey | XLADWPWIZJWNRM-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.453°C at 760 mmHg (Cal.) |
| Flash point | 208.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-3-(4'-Aminophenyl)-3-Ethylpyrrolidine-2,5-Dione |