| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Ambroxol |
|---|---|
| Synonyms | 4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.10 |
| CAS Registry Number | 107814-37-9 |
| EC Number | 242-500-3 |
| SMILES | C1CC(CCC1NCC2=C(C(=CC(=C2)Br)Br)N)O |
| Solubility | 90.45 mg/L (25 ºC water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.654, Calc.* |
| Melting point | 181.53 ºC |
| Boiling Point | 434.89 ºC, 468.6±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 237.2±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Ambroxol |