| E-fine Bio Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15251778053 | |||
![]() |
William.efine@hotmail.com | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | Fezolinetant |
|---|---|
| Synonyms | (4-fluorophenyl)-[(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15FN6OS |
| Molecular Weight | 358.39 |
| CAS Registry Number | 1629229-37-3 |
| EC Number | 855-900-3 |
| SMILES | C[C@@H]1C2=NN=C(N2CCN1C(=O)C3=CC=C(C=C3)F)C4=NC(=NS4)C |
| Density | 1.6±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.760, Calc.* |
| Boiling Point | 623.0±65.0 ºC (760 mmHg), Calc.* |
| Flash Point | 330.5±34.3 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Fezolinetant |