| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() |
+61 3-7003-5401 | |||
![]() |
info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Indoles |
|---|---|
| Name | Ethyl 5-phenyl-1H-indole-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 66616-69-1 |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C3=CC=CC=C3 |
| Solubility | 5.602 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.637, Calc.* |
| Melting point | 161.35 ºC |
| Boiling Point | 428.50 ºC, 463.2±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 233.9±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-phenyl-1H-indole-2-carboxylate |