| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,1,1,2,3,3-Hexafluoro-3-(2,2,3,3,3-Pentafluoropropoxy)Propane |
|---|---|
| Synonyms | 1H,1H,2’H-Perfluorodipropyl ether; 1H,1H,2'H-Perfluorodipropyl ether; 1H,1H,2H-PERFLUORODIPROPYLETHER |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3F11O |
| Molecular Weight | 300.07 |
| CAS Registry Number | 1000-28-8 |
| SMILES | FC(C(F)(F)OCC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6H3F11O/c7-2(4(10,11)12)5(13,14)18-1-3(8,9)6(15,16)17/h2H,1H2 |
| InChIKey | JOROOXPAFHWVRW-UHFFFAOYSA-N |
| Density | 1.5844 (Expl.) |
|---|---|
| 1.543g/cm3 (Cal.) | |
| Boiling point | 81.295°C at 760 mmHg (Cal.) |
| 87.5°C (Expl.) | |
| Flash point | 8.158°C (Cal.) |
| Refractive index | 1.2751 (Expl.) |
| 1.272 (Cal.) | |
| Safety Description | IRRITANT |
|---|---|
| Irritant | |
| R36/37/38 | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,3,3-Hexafluoro-3-(2,2,3,3,3-Pentafluoropropoxy)Propane |