Online Database of Chemicals from Around the World
|
CAS#: 56595-12-1 Product: 2,3,4,5,6,7-Hexafluoro-1,8-Naphthyridine No suppilers available for the product. |
| Name | 2,3,4,5,6,7-Hexafluoro-1,8-Naphthyridine |
|---|---|
| Synonyms | 1,8-Naphthyridine,2,3,4,5,6,7-Hexafluoro- |
| Molecular Structure |  |
| Molecular Formula | C8F6N2 |
| Molecular Weight | 238.09 |
| CAS Registry Number | 56595-12-1 |
| SMILES | C1(=C2C(=NC(=C1F)F)N=C(F)C(=C2F)F)F |
| InChI | 1S/C8F6N2/c9-2-1-3(10)5(12)7(14)16-8(1)15-6(13)4(2)11 |
| InChIKey | AIRIUQTZZWJCDF-UHFFFAOYSA-N |
| Density | 1.76g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.985°C at 760 mmHg (Cal.) |
| Flash point | 118.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5,6,7-Hexafluoro-1,8-Naphthyridine |