Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dihydrospiro[Indene-1,3'-Pyrrolidine]-5,6-Diol |
|---|---|
| Synonyms | 2,3-dihydrospiro[indene-1,3'-pyrrolidine]-5,6-diol |
| Molecular Structure | ![CAS#: 100038-04-8， 2,3-Dihydrospiro[Indene-1,3'-Pyrrolidine]-5,6-Diol](/moreStructures/100038-04-8.gif) |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25 |
| CAS Registry Number | 100038-04-8 |
| SMILES | c1c2c(cc(c1O)O)C3(CC2)CCNC3 |
| InChI | 1S/C12H15NO2/c14-10-5-8-1-2-12(3-4-13-7-12)9(8)6-11(10)15/h5-6,13-15H,1-4,7H2 |
| InChIKey | PKVIUDRPVJREQG-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.157°C at 760 mmHg (Cal.) |
| Flash point | 190.996°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydrospiro[Indene-1,3'-Pyrrolidine]-5,6-Diol |