Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4-Dihydro-2H-spiro[naphthalene-1,3'-pyrrolidine]-5,6-diol |
|---|---|
| Synonyms | 3,4-dihydro-2H-spiro[naphthalene-1,3'-pyrrolidine]-5,6-diol |
| Molecular Structure | ![CAS#: 738534-56-0， 3,4-Dihydro-2H-spiro[naphthalene-1,3'-pyrrolidine]-5,6-diol](/moreStructures/738534-56-0.gif) |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 738534-56-0 |
| SMILES | c1cc(c(c2c1C3(CCC2)CCNC3)O)O |
| InChI | 1S/C13H17NO2/c15-11-4-3-10-9(12(11)16)2-1-5-13(10)6-7-14-8-13/h3-4,14-16H,1-2,5-8H2 |
| InChIKey | FIPHBPNXJLXPCQ-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.259°C at 760 mmHg (Cal.) |
| Flash point | 177.564°C (Cal.) |
| Refractive index | 1.65 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-2H-spiro[naphthalene-1,3'-pyrrolidine]-5,6-diol |