Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S,3R)-2,3-Dihydrospiro[indene-1,4'-piperidine]-2,3-diol |
|---|---|
| Synonyms | (2S,3R)-2,3-dihydrospiro[indene-1,4'-piperidine]-2,3-diol |
| Molecular Structure | ![CAS#: 791042-20-1， (2S,3R)-2,3-Dihydrospiro[indene-1,4'-piperidine]-2,3-diol](/moreStructures/791042-20-1.gif) |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 791042-20-1 |
| SMILES | c1ccc2c(c1)[C@H]([C@H](C23CCNCC3)O)O |
| InChI | 1S/C13H17NO2/c15-11-9-3-1-2-4-10(9)13(12(11)16)5-7-14-8-6-13/h1-4,11-12,14-16H,5-8H2/t11-,12-/m1/s1 |
| InChIKey | UKJSYEIVCGFUES-VXGBXAGGSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.689°C at 760 mmHg (Cal.) |
| Flash point | 167.498°C (Cal.) |
| Refractive index | 1.64 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-2,3-Dihydrospiro[indene-1,4'-piperidine]-2,3-diol |