Online Database of Chemicals from Around the World
|
CAS#: 100937-53-9 Product: 1,4-Dideoxy-1,4-Iminoarabinitol No suppilers available for the product. |
| Name | 1,4-Dideoxy-1,4-Iminoarabinitol |
|---|---|
| Synonyms | (2S,3S,4S)-2-Methylolpyrrolidine-3,4-Diol; 1,4-Ddir; 1,4-Dideoxy-1,4-Iminoarabinitol |
| Molecular Structure |  |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 |
| CAS Registry Number | 100937-53-9 |
| SMILES | [C@H]1(O)[C@@H](NC[C@@H]1O)CO |
| InChI | 1S/C5H11NO3/c7-2-3-5(9)4(8)1-6-3/h3-9H,1-2H2/t3-,4-,5-/m0/s1 |
| InChIKey | OQEBIHBLFRADNM-YUPRTTJUSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.128°C at 760 mmHg (Cal.) |
| Flash point | 188.824°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dideoxy-1,4-Iminoarabinitol |