Online Database of Chemicals from Around the World
|
CAS#: 120576-71-8 Product: 1,4-Dideoxy-1,4-Iminoallitol No suppilers available for the product. |
| Name | 1,4-Dideoxy-1,4-Iminoallitol |
|---|---|
| Synonyms | 1,4-Dia; 1,4-Dideoxy-1,4-Imino-L-Allitol; 1,4-Dideoxy-1,4-Iminoallitol |
| Molecular Structure |  |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 120576-71-8 |
| SMILES | [C@H]1(NC[C@H]([C@H]1O)O)C(CO)O |
| InChI | 1S/C6H13NO4/c8-2-4(10)5-6(11)3(9)1-7-5/h3-11H,1-2H2/t3-,4?,5+,6-/m1/s1 |
| InChIKey | RVNSAAIWCWTCTJ-ZPQYLTHOSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.608°C at 760 mmHg (Cal.) |
| Flash point | 257.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dideoxy-1,4-Iminoallitol |