| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 1,1-Dimethylethyl 6-formyl-2,2-dimethyl-1,3-dioxane-4-acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 |
| CAS Registry Number | 1044518-75-3 |
| SMILES | CC1(OC(CC(O1)C=O)CC(=O)OC(C)(C)C)C |
| Solubility | 409.9 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.470, Calc.* |
| Melting point | 89.42 °C |
| Boiling Point | 316.66 °C, 320.3±32.0 °C (760 mmHg), Calc.* |
| Flash Point | 140.6±13.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dimethylethyl 6-formyl-2,2-dimethyl-1,3-dioxane-4-acetate |