Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-(1,1-Dimethylethyl)-4,4A,5,6,7,8-Hexahydro-4-Methyl-2(3H)-Naphthalenone |
|---|---|
| Synonyms | 6-(1,1-Dimethylethyl)-4,4A,5,6,7,8-Hexahydro-4-Methylnaphthalen-2(3H)-One |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 93904-55-3 |
| EINECS | 299-794-1 |
| SMILES | CC1C2C(=CC(=O)C1)CCC(C2)C(C)(C)C |
| InChI | 1S/C15H24O/c1-10-7-13(16)8-11-5-6-12(9-14(10)11)15(2,3)4/h8,10,12,14H,5-7,9H2,1-4H3 |
| InChIKey | NPEWVIACCSYRRQ-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.349°C at 760 mmHg (Cal.) |
| Flash point | 144.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1,1-Dimethylethyl)-4,4A,5,6,7,8-Hexahydro-4-Methyl-2(3H)-Naphthalenone |