Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Dimethyl 2-Ethyl-3,4-Furandicarboxylate |
|---|---|
| Synonyms | dimethyl 2-ethylfuran-3,4-dicarboxylate; NSC163403 |
| Molecular Structure |  |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 500872-66-2 |
| SMILES | O=C(OC)c1c(occ1C(=O)OC)CC |
| InChI | 1S/C10H12O5/c1-4-7-8(10(12)14-3)6(5-15-7)9(11)13-2/h5H,4H2,1-3H3 |
| InChIKey | FSKGHVMUAVKZQC-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.069°C at 760 mmHg (Cal.) |
| Flash point | 123.786°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2-Ethyl-3,4-Furandicarboxylate |