|
CAS#: 109751-82-8 Product: Trimethylsilyl (2Z)-3-Methyl-4-(Trimethylsilyl)-2-Butenoate No suppilers available for the product. |
| Name | Trimethylsilyl (2Z)-3-Methyl-4-(Trimethylsilyl)-2-Butenoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H24O2Si2 |
| Molecular Weight | 244.48 |
| CAS Registry Number | 109751-82-8 |
| SMILES | O=C(O[Si](C)(C)C)/C=C(/C)C[Si](C)(C)C |
| InChI | 1S/C11H24O2Si2/c1-10(9-14(2,3)4)8-11(12)13-15(5,6)7/h8H,9H2,1-7H3/b10-8- |
| InChIKey | QCGGJRHSTCBUNL-NTMALXAHSA-N |
| Density | 0.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.3°C at 760 mmHg (Cal.) |
| Flash point | 81.5°C (Cal.) |
| Refractive index | 1.431 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl (2Z)-3-Methyl-4-(Trimethylsilyl)-2-Butenoate |