Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-[(Trimethylsilyl)methyl]quinoline |
|---|---|
| Synonyms | 3-((trimethylsilyl)methyl)quinoline |
| Molecular Structure | ![CAS#: 65094-36-2， 3-[(Trimethylsilyl)methyl]quinoline](/moreStructures/65094-36-2.gif) |
| Molecular Formula | C13H17NSi |
| Molecular Weight | 215.37 |
| CAS Registry Number | 65094-36-2 |
| SMILES | C[Si](C)(C)Cc1cc2ccccc2nc1 |
| InChI | 1S/C13H17NSi/c1-15(2,3)10-11-8-12-6-4-5-7-13(12)14-9-11/h4-9H,10H2,1-3H3 |
| InChIKey | XQACVRWYSOGVIU-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.868°C at 760 mmHg (Cal.) |
| Flash point | 131.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(Trimethylsilyl)methyl]quinoline |