Online Database of Chemicals from Around the World
|
CAS#: 55124-90-8 Product: Trimethylsilyl 3-Methyl-3-[(Trimethylsilyl)Oxy]Butanoate No suppilers available for the product. |
| Name | Trimethylsilyl 3-Methyl-3-[(Trimethylsilyl)Oxy]Butanoate |
|---|---|
| Synonyms | 3-Hydroxyisovaleric acid, bis-TMS; 3-Hydroxyisovaleric acid, di-TMS; 3-Trimethylsilyloxyisovaleric acid,trimethylsilyl ester |
| Molecular Structure | ![CAS#: 55124-90-8， Trimethylsilyl 3-Methyl-3-[(Trimethylsilyl)Oxy]Butanoate](/moreStructures/55124-90-8.gif) |
| Molecular Formula | C11H26O3Si2 |
| Molecular Weight | 262.49 |
| CAS Registry Number | 55124-90-8 |
| SMILES | O=C(O[Si](C)(C)C)CC(O[Si](C)(C)C)(C)C |
| InChI | 1S/C11H26O3Si2/c1-11(2,14-16(6,7)8)9-10(12)13-15(3,4)5/h9H2,1-8H3 |
| InChIKey | CEMBCVWMQGTNRL-UHFFFAOYSA-N |
| Density | 0.901g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.906°C at 760 mmHg (Cal.) |
| Flash point | 80.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 3-Methyl-3-[(Trimethylsilyl)Oxy]Butanoate |