Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4,6-Dimethyldibenzofuran |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 1136-77-2 |
| EINECS | 214-500-3 |
| SMILES | C1=CC=C(C3=C1C2=CC=CC(=C2O3)C)C |
| InChI | 1S/C14H12O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h3-8H,1-2H3 |
| InChIKey | PVBRAGJTHQZENQ-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.944°C at 760 mmHg (Cal.) |
| Flash point | 156.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyldibenzofuran |