Online Database of Chemicals from Around the World
| Name | 7,14-Dimethyldibenz(a,j)Anthracene |
|---|---|
| Synonyms | 7,14-Dmdb(A,J)A; Dibenz(A,J)Anthracene, 7,14-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 |
| CAS Registry Number | 63041-63-4 |
| SMILES | C1=C5C(=C2C(=C1)C(=C4C(=C2C)C3=CC=CC=C3C=C4)C)C=CC=C5 |
| InChI | 1S/C24H18/c1-15-19-13-11-17-7-3-5-9-21(17)23(19)16(2)24-20(15)14-12-18-8-4-6-10-22(18)24/h3-14H,1-2H3 |
| InChIKey | BSSDJTZAIHVWAM-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.802°C at 760 mmHg (Cal.) |
| Flash point | 279.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,14-Dimethyldibenz(a,j)Anthracene |
