Online Database of Chemicals from Around the World
| Name | 6-Methyl-1,3,8-Trichlorodibenzofuran |
|---|---|
| Synonyms | 1,3,8-Trichloro-6-Methyl-Dibenzofuran; 6-Mcdf; Aids-105029 |
| Molecular Structure |  |
| Molecular Formula | C13H7Cl3O |
| Molecular Weight | 285.56 |
| CAS Registry Number | 115039-00-4 |
| SMILES | C1=C(Cl)C=C(C2=C1C3=C(O2)C=C(Cl)C=C3Cl)C |
| InChI | 1S/C13H7Cl3O/c1-6-2-7(14)3-9-12-10(16)4-8(15)5-11(12)17-13(6)9/h2-5H,1H3 |
| InChIKey | RPMARRQIRRJWEZ-UHFFFAOYSA-N |
| Density | 1.483g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.343°C at 760 mmHg (Cal.) |
| Flash point | 198.34°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-1,3,8-Trichlorodibenzofuran |
