Online Database of Chemicals from Around the World
| Name | 1-Methyl-2-(Trichloromethyl)Benzene |
|---|---|
| Synonyms | Alpha,Alpha,Alpha-Trichloro-O-Xylene; Benzene, 1-Methyl-2-(Trichloromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl3 |
| Molecular Weight | 209.50 |
| CAS Registry Number | 3335-33-9 |
| EINECS | 222-069-8 |
| SMILES | C1=CC=CC(=C1C(Cl)(Cl)Cl)C |
| InChI | 1S/C8H7Cl3/c1-6-4-2-3-5-7(6)8(9,10)11/h2-5H,1H3 |
| InChIKey | CBXDCGQZMAUIHD-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.196°C at 760 mmHg (Cal.) |
| Flash point | 150.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-(Trichloromethyl)Benzene |
