Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Methyl-4-(Trichloromethyl)-2,5-Cyclohexadien-1-Ol |
|---|---|
| Synonyms | 4-Methyl-4-(Trichloromethyl)-1-Cyclohexa-2,5-Dienol; 2,5-Cyclohexadien-1-Ol, 4-Methyl-4-(Trichloromethyl)-; Nsc202024 |
| Molecular Structure |  |
| Molecular Formula | C8H9Cl3O |
| Molecular Weight | 227.52 |
| CAS Registry Number | 13630-61-0 |
| SMILES | CC1(C(Cl)(Cl)Cl)C=CC(O)C=C1 |
| InChI | 1S/C8H9Cl3O/c1-7(8(9,10)11)4-2-6(12)3-5-7/h2-6,12H,1H3 |
| InChIKey | KVSODBDEYXPYND-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.499°C at 760 mmHg (Cal.) |
| Flash point | 130.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-4-(Trichloromethyl)-2,5-Cyclohexadien-1-Ol |