Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (2E)-3-Amino-2-Nitro-2-Butenoate |
|---|---|
| Synonyms | (E)-methyl 3-amino-2-nitrobut-2-enoate |
| Molecular Structure |  |
| Molecular Formula | C5H8N2O4 |
| Molecular Weight | 160.13 |
| CAS Registry Number | 120697-14-5 |
| SMILES | N/C(C)=C(\C(=O)OC)[N+]([O-])=O |
| InChI | 1S/C5H8N2O4/c1-3(6)4(7(9)10)5(8)11-2/h6H2,1-2H3/b4-3+ |
| InChIKey | WFVLBKZYKQASMS-ONEGZZNKSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.257°C at 760 mmHg (Cal.) |
| Flash point | 120.876°C (Cal.) |
| Refractive index | 1.496 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E)-3-Amino-2-Nitro-2-Butenoate |