Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-[3-(Methylamino)-4-Nitrophenoxy]Ethanol |
|---|---|
| Synonyms | 2-(3-Methylamino-4-Nitro-Phenoxy)Ethanol; 2-(3-(Methylamino)-4-Nitrophenoxy)Ethanol; 3-Methylamino-4-Nitrophenoxyethanol |
| Molecular Structure | ![CAS#: 59820-63-2， 2-[3-(Methylamino)-4-Nitrophenoxy]Ethanol](/moreStructures/59820-63-2.gif) |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 |
| CAS Registry Number | 59820-63-2 |
| EINECS | 261-940-7 |
| SMILES | C1=C(OCCO)C=C(C(=C1)[N+]([O-])=O)NC |
| InChI | 1S/C9H12N2O4/c1-10-8-6-7(15-5-4-12)2-3-9(8)11(13)14/h2-3,6,10,12H,4-5H2,1H3 |
| InChIKey | IUTYXFLUCZMDMM-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.841°C at 760 mmHg (Cal.) |
| Flash point | 215.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[3-(Methylamino)-4-Nitrophenoxy]Ethanol |