Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-Amino-4-Nitrobutanoate |
|---|---|
| Synonyms | methyl 2-amino-4-nitrobutanoate |
| Molecular Structure |  |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 |
| CAS Registry Number | 245368-86-9 |
| SMILES | COC(=O)C(CC[N+](=O)[O-])N |
| InChI | 1S/C5H10N2O4/c1-11-5(8)4(6)2-3-7(9)10/h4H,2-3,6H2,1H3 |
| InChIKey | OHLRHYCLFDMBNB-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.106°C at 760 mmHg (Cal.) |
| Flash point | 108.689°C (Cal.) |
| Refractive index | 1.468 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Amino-4-Nitrobutanoate |