Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Isobutyl 3,4-Diaminobenzoate |
|---|---|
| Synonyms | isobutyl 3,4-diaminobenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 121649-62-5 |
| SMILES | CC(C)COC(=O)c1ccc(c(c1)N)N |
| InChI | 1S/C11H16N2O2/c1-7(2)6-15-11(14)8-3-4-9(12)10(13)5-8/h3-5,7H,6,12-13H2,1-2H3 |
| InChIKey | DQQODHGDWOLVJH-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.277°C at 760 mmHg (Cal.) |
| Flash point | 197.269°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobutyl 3,4-Diaminobenzoate |