Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Isobutyl 3,5-diamino-1H-pyrazole-4-carboxylate |
|---|---|
| Synonyms | isobutyl 3,5-diamino-1H-pyrazole-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 82819-88-3 |
| SMILES | CC(C)COC(=O)c1c([nH]nc1N)N |
| InChI | 1S/C8H14N4O2/c1-4(2)3-14-8(13)5-6(9)11-12-7(5)10/h4H,3H2,1-2H3,(H5,9,10,11,12) |
| InChIKey | YCIRSTBYELPYAG-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.517°C at 760 mmHg (Cal.) |
| Flash point | 204.493°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobutyl 3,5-diamino-1H-pyrazole-4-carboxylate |