|
CAS#: 121770-19-2 Product: Levodopa 4-Hydroxybutyl Ester No suppilers available for the product. |
| Name | Levodopa 4-Hydroxybutyl Ester |
|---|---|
| Synonyms | (2S)-2-Amino-3-(3-Butoxy-4-Hydroxy-Phenyl)Propanoic Acid; (2S)-2-Amino-3-(3-Butoxy-4-Hydroxy-Phenyl)Propionic Acid; Levodopa 4-Hydroxybutyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 121770-19-2 |
| SMILES | [C@H](CC1=CC(=C(C=C1)O)OCCCC)(C(O)=O)N |
| InChI | 1S/C13H19NO4/c1-2-3-6-18-12-8-9(4-5-11(12)15)7-10(14)13(16)17/h4-5,8,10,15H,2-3,6-7,14H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | XPKFGLSHFSMLRL-JTQLQIEISA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.48°C at 760 mmHg (Cal.) |
| Flash point | 216.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Levodopa 4-Hydroxybutyl Ester |