| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | N-Phenoxycarbonyl-L-valine |
|---|---|
| Synonyms | (2S)-3-methyl-2-(phenoxycarbonylamino)butanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 |
| CAS Registry Number | 126147-70-4 |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OC1=CC=CC=C1 |
| Solubility | 2197 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.533, Calc.* |
| Melting point | 123.73 °C |
| Boiling Point | 360.83 °C, 374.1±34.0 °C (760 mmHg), Calc.* |
| Flash Point | 180.1±25.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319 Details |
| Safety Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N-Phenoxycarbonyl-L-valine |