Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Phenoxycyclopropanecarbonyl chloride |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 |
| CAS Registry Number | 90797-97-0 |
| SMILES | C1C(C1OC2=CC=CC=C2)C(=O)Cl |
| InChI | 1S/C10H9ClO2/c11-10(12)8-6-9(8)13-7-4-2-1-3-5-7/h1-5,8-9H,6H2 |
| InChIKey | QULPVACMFCIEGY-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.7±33.0°C at 760 mmHg (Cal.) |
| Flash point | 102.7±25.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenoxycyclopropanecarbonyl chloride |