Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-Phenoxycyclopentanamine |
|---|---|
| Synonyms | (1R,2R)-2-phenoxycyclopentanamine |
| Molecular Structure |  |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.24 |
| CAS Registry Number | 767603-10-1 |
| SMILES | c1ccc(cc1)O[C@@H]2CCC[C@H]2N |
| InChI | 1S/C11H15NO/c12-10-7-4-8-11(10)13-9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2/t10-,11-/m1/s1 |
| InChIKey | WEBWXWDQSPNZHG-GHMZBOCLSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.562°C at 760 mmHg (Cal.) |
| Flash point | 121.778°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Phenoxycyclopentanamine |