Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,4-Dimethoxy-Anthracene |
|---|---|
| Synonyms | Nsc 106547; Anthracene, 1,4-Dimethoxy-; Nsc106547 |
| Molecular Structure |  |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 13076-29-4 |
| SMILES | C2=C1C=CC=CC1=CC3=C(C=CC(=C23)OC)OC |
| InChI | 1S/C16H14O2/c1-17-15-7-8-16(18-2)14-10-12-6-4-3-5-11(12)9-13(14)15/h3-10H,1-2H3 |
| InChIKey | YCTBFSAWJWMRGO-UHFFFAOYSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.554°C at 760 mmHg (Cal.) |
| Flash point | 178.861°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethoxy-Anthracene |