Online Database of Chemicals from Around the World
| Name | 1,3-Dimethoxy-9,10-Anthraquinone |
|---|---|
| Synonyms | AIDS131770; AIDS-131770; NSC624611 |
| Molecular Structure |  |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 |
| CAS Registry Number | 1989-42-0 |
| SMILES | O=C2c1ccccc1C(=O)c3c2cc(OC)cc3OC |
| InChI | 1S/C16H12O4/c1-19-9-7-12-14(13(8-9)20-2)16(18)11-6-4-3-5-10(11)15(12)17/h3-8H,1-2H3 |
| InChIKey | ILRJFVJXKPFIAB-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.087°C at 760 mmHg (Cal.) |
| Flash point | 207.91°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethoxy-9,10-Anthraquinone |
