|
CAS#: 54150-69-5 Product: 2,4-Dimethoxyaniline Hydrochloride No suppilers available for the product. |
| Name | 2,4-Dimethoxyaniline Hydrochloride |
|---|---|
| Synonyms | (2,4-Dimethoxyphenyl)Amine Hydrochloride; Ncgc00091947-01; 2,4-Dimethoxyaniline.Hcl |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 |
| CAS Registry Number | 54150-69-5 |
| SMILES | [H+].C1=C(C(=CC=C1OC)N)OC.[Cl-] |
| InChI | 1S/C8H11NO2.ClH/c1-10-6-3-4-7(9)8(5-6)11-2;/h3-5H,9H2,1-2H3;1H |
| InChIKey | PFHRGNBFRBWOPD-UHFFFAOYSA-N |
| Boiling point | 267.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethoxyaniline Hydrochloride |