Online Database of Chemicals from Around the World
|
CAS#: 13623-47-7 Product: 2-(4'-Aminobenzyl)Imidazoline No suppilers available for the product. |
| Name | 2-(4'-Aminobenzyl)Imidazoline |
|---|---|
| Synonyms | [4-(4,5-Dihydro-1H-Imidazol-2-Ylmethyl)Phenyl]Amine; 2-(4'-Aminobenzyl)Imidazoline; 2-Abi |
| Molecular Structure |  |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 |
| CAS Registry Number | 13623-47-7 |
| SMILES | C1=C(C=CC(=C1)N)CC2=NCCN2 |
| InChI | 1S/C10H13N3/c11-9-3-1-8(2-4-9)7-10-12-5-6-13-10/h1-4H,5-7,11H2,(H,12,13) |
| InChIKey | NTVVAXXCLZJWPT-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.741°C at 760 mmHg (Cal.) |
| Flash point | 205.233°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4'-Aminobenzyl)Imidazoline |