Online Database of Chemicals from Around the World
|
CAS#: 42398-69-6 Product: 1-(4-Aminobenzyl)Isoquinoline No suppilers available for the product. |
| Name | 1-(4-Aminobenzyl)Isoquinoline |
|---|---|
| Synonyms | 4-(Phenylmethyl)-1-Isoquinolinamine; [4-(Benzyl)-1-Isoquinolyl]Amine; 1-(4-Aminobenzyl)Isoquinoline |
| Molecular Structure |  |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 |
| CAS Registry Number | 42398-69-6 |
| SMILES | C1=NC(=C3C(=C1CC2=CC=CC=C2)C=CC=C3)N |
| InChI | 1S/C16H14N2/c17-16-15-9-5-4-8-14(15)13(11-18-16)10-12-6-2-1-3-7-12/h1-9,11H,10H2,(H2,17,18) |
| InChIKey | NUPSDJAQBLLBGS-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.207°C at 760 mmHg (Cal.) |
| Flash point | 247.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Aminobenzyl)Isoquinoline |