|
CAS#: 13934-03-7 Product: Pyridoxylidene-L-Glutamic Acid Dipotassium Salt No suppilers available for the product. |
| Classification | Biochemical >> Amino acids and their derivatives >> Glutamic acid derivative |
|---|---|
| Name | Pyridoxylidene-L-Glutamic Acid Dipotassium Salt |
| Synonyms | (2S)-2-[[(E)-[5-(Hydroxymethyl)-2-Methyl-3-Oxo-4-Pyridylidene]Methyl]Amino]Pentanedioic Acid; (2S)-2-[[(E)-(3-Keto-2-Methyl-5-Methylol-4-Pyridylidene)Methyl]Amino]Glutaric Acid; (2S)-2-[[(E)-[5-(Hydroxymethyl)-2-Methyl-3-Oxo-Pyridin-4-Ylidene]Methyl]Amino]Pentanedioic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 |
| CAS Registry Number | 13934-03-7 |
| SMILES | [C@H](N\C=C1/C(=CN=C(C1=O)C)CO)(CCC(O)=O)C(O)=O |
| InChI | 1S/C13H16N2O6/c1-7-12(19)9(8(6-16)4-14-7)5-15-10(13(20)21)2-3-11(17)18/h4-5,10,15-16H,2-3,6H2,1H3,(H,17,18)(H,20,21)/b9-5+/t10-/m0/s1 |
| InChIKey | XKBXXIDGNQTCSE-CYNRKNSPSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.691°C at 760 mmHg (Cal.) |
| Flash point | 292.896°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pyridoxylidene-L-Glutamic Acid Dipotassium Salt |