| Improve Medical Technology (Nanxiong) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.nximprove-medical.com | |||
![]() | +86 (571) 383-6997 | |||
![]() | nxyp-sales@improve-medical.com 2571405487@qq.com | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink Standard supplier since 2017 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridine compound |
|---|---|
| Name | Pyridoxine tris-hexyldecanoate |
| Synonyms | [5-(2-hexyldecanoyloxy)-4-(2-hexyldecanoyloxymethyl)-6-methylpyridin-3-yl]methyl 2-hexyldecanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C56H101NO6 |
| Molecular Weight | 884.40 |
| CAS Registry Number | 564478-51-9 |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC1=CN=C(C(=C1COC(=O)C(CCCCCC)CCCCCCCC)OC(=O)C(CCCCCC)CCCCCCCC)C |
| Density | 0.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.482, Calc.* |
| Boiling Point | 818.9±65.0 °C (760 mmHg), Calc.* |
| Flash Point | 449.0±34.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
|
Pyridoxine tris-hexyldecanoate is a chemical compound formed by the esterification of pyridoxine, commonly known as vitamin B6, with hexyldecanoic acid. This derivative is synthesized to enhance the properties and applications of pyridoxine in various industrial and biomedical fields. The discovery of pyridoxine tris-hexyldecanoate stems from the need to improve the solubility and stability of pyridoxine in different formulations. Pyridoxine itself is a vital vitamin involved in numerous physiological functions, including amino acid metabolism, neurotransmitter synthesis, and the maintenance of healthy skin and nerves. However, its application can be limited due to its poor solubility in non-aqueous solvents and instability under certain conditions. To address these limitations, researchers have developed various derivatives, including pyridoxine tris-hexyldecanoate, to enhance its usability. The synthesis of pyridoxine tris-hexyldecanoate involves reacting pyridoxine with hexyldecanoic acid in the presence of a suitable catalyst. The resulting esterification process yields a compound where the hydroxyl groups of pyridoxine are esterified with hexyldecanoic acid, forming a more hydrophobic and stable molecule. This modification improves the compound's solubility in organic solvents and its stability under different conditions. One of the primary applications of pyridoxine tris-hexyldecanoate is in the formulation of pharmaceutical and nutraceutical products. In these contexts, the compound serves as an effective means to enhance the bioavailability of vitamin B6. The esterification with hexyldecanoic acid not only increases the solubility of pyridoxine in oil-based formulations but also stabilizes the vitamin against degradation. This is particularly useful in the development of dietary supplements and functional foods where vitamin stability is crucial. Additionally, pyridoxine tris-hexyldecanoate finds applications in cosmetic formulations. Its enhanced solubility and stability make it a valuable ingredient in skincare and cosmetic products. In cosmetics, pyridoxine plays a role in promoting healthy skin by participating in various biochemical processes. The ester derivative ensures that pyridoxine remains effective in topical applications, providing benefits such as improved skin hydration, reduced inflammation, and enhanced skin repair. In the field of material science, pyridoxine tris-hexyldecanoate has potential uses as a modifying agent in the development of advanced materials. Its ability to interact with different substrates and its stability make it a candidate for incorporation into polymer matrices and coatings. This can lead to the creation of materials with tailored properties, such as improved durability or specific functional characteristics. The enhanced properties of pyridoxine tris-hexyldecanoate also extend to its use in biomedical research. The compound can be employed in the design of controlled-release systems for vitamin delivery, where its esterified form allows for a more sustained release of pyridoxine over time. This application is particularly beneficial in therapeutic settings where maintaining optimal levels of vitamin B6 is important for managing certain health conditions. In summary, pyridoxine tris-hexyldecanoate represents a significant advancement in the functionalization of pyridoxine, addressing its limitations in solubility and stability. Its diverse applications in pharmaceuticals, cosmetics, material science, and biomedical research highlight its importance as a versatile and effective compound. |
| Market Analysis Reports |