Online Database of Chemicals from Around the World
| Name | 5,11-Dimethylchrysene |
|---|---|
| Synonyms | Chrysene, 5,11-Dimethyl-; Brn 2105855 |
| Molecular Structure |  |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 14207-78-4 |
| SMILES | C1=CC=CC4=C1C2=C(C3=C(C=C2C)C=CC=C3)C(=C4)C |
| InChI | 1S/C20H16/c1-13-11-15-7-3-6-10-18(15)20-14(2)12-16-8-4-5-9-17(16)19(13)20/h3-12H,1-2H3 |
| InChIKey | XNZPTUHWIUJQKB-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.461°C at 760 mmHg (Cal.) |
| Flash point | 227.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,11-Dimethylchrysene |
